EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38O7 |
| Net Charge | 0 |
| Average Mass | 510.627 |
| Monoisotopic Mass | 510.26175 |
| SMILES | [H][C@]12Cc3cc(/C=C/c4cc(O)c5c(c4)OC(C)(C)C(O)C5)cc(OC)c3O[C@]1(C)C[C@@H](O)[C@@H](O)C2(C)C |
| InChI | InChI=1S/C30H38O7/c1-28(2)24-13-18-9-16(12-23(35-6)26(18)37-30(24,5)15-21(32)27(28)34)7-8-17-10-20(31)19-14-25(33)29(3,4)36-22(19)11-17/h7-12,21,24-25,27,31-34H,13-15H2,1-6H3/b8-7+/t21-,24-,25?,27-,30-/m1/s1 |
| InChIKey | RFLJGOACFXZRHJ-ZHIKFPNPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga alnifolia (ncbitaxon:396448) | fruit (BTO:0000486) | PubMed (17326683) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| schweinfurthin H (CHEBI:66438) has role antineoplastic agent (CHEBI:35610) |
| schweinfurthin H (CHEBI:66438) has role metabolite (CHEBI:25212) |
| schweinfurthin H (CHEBI:66438) is a chromanes (CHEBI:23230) |
| schweinfurthin H (CHEBI:66438) is a organic heterotricyclic compound (CHEBI:26979) |
| schweinfurthin H (CHEBI:66438) is a phenols (CHEBI:33853) |
| schweinfurthin H (CHEBI:66438) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| (2S,3R,4aR,9aR)-7-[(E)-2-(3,5-dihydroxy-2,2-dimethyl-3,4-dihydro-2H-chromen-7-yl)ethenyl]-5-methoxy-1,1,4a-trimethyl-2,3,4,4a,9,9a-hexahydro-1H-xanthene-2,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11042131 | Reaxys |
| Citations |
|---|