EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36O5 |
| Net Charge | 0 |
| Average Mass | 464.602 |
| Monoisotopic Mass | 464.25627 |
| SMILES | [H][C@]12Cc3cc(/C=C/c4cc(O)c(CC=C(C)C)c(O)c4)cc(O)c3O[C@]1(C)CC[C@@H](O)C2(C)C |
| InChI | InChI=1S/C29H36O5/c1-17(2)6-9-21-22(30)13-19(14-23(21)31)8-7-18-12-20-16-25-28(3,4)26(33)10-11-29(25,5)34-27(20)24(32)15-18/h6-8,12-15,25-26,30-33H,9-11,16H2,1-5H3/b8-7+/t25-,26-,29-/m1/s1 |
| InChIKey | CGJIPMVTBQUUQL-GEDZTWKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga alnifolia (ncbitaxon:396448) | fruit (BTO:0000486) | PubMed (17326683) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| schweinfurthin G (CHEBI:66437) has functional parent vedelianin (CHEBI:66352) |
| schweinfurthin G (CHEBI:66437) has role antineoplastic agent (CHEBI:35610) |
| schweinfurthin G (CHEBI:66437) has role metabolite (CHEBI:25212) |
| schweinfurthin G (CHEBI:66437) is a cyclic ether (CHEBI:37407) |
| schweinfurthin G (CHEBI:66437) is a organic heterotricyclic compound (CHEBI:26979) |
| schweinfurthin G (CHEBI:66437) is a resorcinols (CHEBI:33572) |
| schweinfurthin G (CHEBI:66437) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| (2R,4aR,9aR)-7-{(E)-2-[3,5-dihydroxy-4-(3-methylbut-2-en-1-yl)phenyl]ethenyl}-1,1,4a-trimethyl-2,3,4,4a,9,9a-hexahydro-1H-xanthene-2,5-diol |
| Synonyms | Source |
|---|---|
| (+)-(2R,4aR,9aR)-schweinfurthin G | ChEBI |
| 3-deoxyvedelianin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11042130 | Reaxys |
| Citations |
|---|