EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38O5 |
| Net Charge | 0 |
| Average Mass | 478.629 |
| Monoisotopic Mass | 478.27192 |
| SMILES | [H][C@]12Cc3cc(/C=C/c4cc(O)c(CC=C(C)C)c(O)c4)cc(OC)c3O[C@]1(C)CC[C@@H](O)C2(C)C |
| InChI | InChI=1S/C30H38O5/c1-18(2)7-10-22-23(31)14-20(15-24(22)32)9-8-19-13-21-17-26-29(3,4)27(33)11-12-30(26,5)35-28(21)25(16-19)34-6/h7-9,13-16,26-27,31-33H,10-12,17H2,1-6H3/b9-8+/t26-,27-,30-/m1/s1 |
| InChIKey | BUFNPAYKUGAAAO-HLULBIOLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga alnifolia (ncbitaxon:396448) | fruit (BTO:0000486) | PubMed (17326683) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| schweinfurthin F (CHEBI:66436) has role metabolite (CHEBI:25212) |
| schweinfurthin F (CHEBI:66436) is a cyclic ether (CHEBI:37407) |
| schweinfurthin F (CHEBI:66436) is a organic heterotricyclic compound (CHEBI:26979) |
| schweinfurthin F (CHEBI:66436) is a resorcinols (CHEBI:33572) |
| schweinfurthin F (CHEBI:66436) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 5-{(E)-2-[(2R,4aR,9aR)-2-hydroxy-5-methoxy-1,1,4a-trimethyl-2,3,4,4a,9,9a-hexahydro-1H-xanthen-7-yl]ethenyl}-2-(3-methylbut-2-en-1-yl)benzene-1,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10738215 | Reaxys |
| Citations |
|---|