EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38O6 |
| Net Charge | 0 |
| Average Mass | 494.628 |
| Monoisotopic Mass | 494.26684 |
| SMILES | [H][C@]12Cc3cc(/C=C/c4cc(O)c(CC=C(C)C)c(O)c4)cc(OC)c3O[C@]1(C)C[C@@H](O)[C@@H](O)C2(C)C |
| InChI | InChI=1S/C30H38O6/c1-17(2)7-10-21-22(31)12-19(13-23(21)32)9-8-18-11-20-15-26-29(3,4)28(34)24(33)16-30(26,5)36-27(20)25(14-18)35-6/h7-9,11-14,24,26,28,31-34H,10,15-16H2,1-6H3/b9-8+/t24-,26-,28-,30-/m1/s1 |
| InChIKey | IYHZCJNEODJYKB-DMCZWXATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga alnifolia (ncbitaxon:396448) | fruit (BTO:0000486) | PubMed (17326683) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| schweinfurthin E (CHEBI:66435) has functional parent vedelianin (CHEBI:66352) |
| schweinfurthin E (CHEBI:66435) has role metabolite (CHEBI:25212) |
| schweinfurthin E (CHEBI:66435) is a cyclic ether (CHEBI:37407) |
| schweinfurthin E (CHEBI:66435) is a organic heterotricyclic compound (CHEBI:26979) |
| schweinfurthin E (CHEBI:66435) is a resorcinols (CHEBI:33572) |
| schweinfurthin E (CHEBI:66435) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| (2S,3R,4aR,9aR)-7-{(E)-2-[3,5-dihydroxy-4-(3-methylbut-2-en-1-yl)phenyl]ethenyl}-5-methoxy-1,1,4a-trimethyl-2,3,4,4a,9,9a-hexahydro-1H-xanthene-2,3-diol |
| Synonym | Source |
|---|---|
| 5-O-methylvedelianin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11042129 | Reaxys |
| Citations |
|---|