EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36O6 |
| Net Charge | 0 |
| Average Mass | 492.612 |
| Monoisotopic Mass | 492.25119 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc([C@@H]2CC(=O)c3c(cc(O)c(CC=C(C)C)c3O)O2)cc(O)c1O |
| InChI | InChI=1S/C30H36O6/c1-17(2)7-6-8-19(5)10-11-20-13-21(14-25(33)29(20)34)26-16-24(32)28-27(36-26)15-23(31)22(30(28)35)12-9-18(3)4/h7,9-10,13-15,26,31,33-35H,6,8,11-12,16H2,1-5H3/b19-10+/t26-/m0/s1 |
| InChIKey | LFIGQOMCYZOIQK-XBPZWBIKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schizolaena hystrix (IPNI:790101-1) | fruit (BTO:0000486) | PubMed (15787448) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| schizolaenone B (CHEBI:66434) has role antineoplastic agent (CHEBI:35610) |
| schizolaenone B (CHEBI:66434) has role metabolite (CHEBI:25212) |
| schizolaenone B (CHEBI:66434) is a 4'-hydroxyflavanones (CHEBI:140331) |
| schizolaenone B (CHEBI:66434) is a tetrahydroxyflavanone (CHEBI:38742) |
| IUPAC Name |
|---|
| (2S)-2-{3-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-4,5-dihydroxyphenyl}-5,7-dihydroxy-6-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| (2S)-5,7,3',4'-tetrahydroxy-6-(3-methyl-but-2-enyl)-3'-(geranyl)flavanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11068914 | Reaxys |
| Citations |
|---|