EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@]12CC=C(CO)CC[C@]1(C)CC[C@H]2C(C)(C)O |
| InChI | InChI=1S/C15H26O2/c1-14(2,17)12-7-9-15(3)8-6-11(10-16)4-5-13(12)15/h4,12-13,16-17H,5-10H2,1-3H3/t12-,13-,15-/m1/s1 |
| InChIKey | QNYUIPNTIJJURA-UMVBOHGHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schisandra wilsoniana (IPNI:555083-1) | fruit (BTO:0000486) | PubMed (19228000) |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| schisanwilsonene A (CHEBI:66432) has role anti-HBV agent (CHEBI:64951) |
| schisanwilsonene A (CHEBI:66432) has role metabolite (CHEBI:25212) |
| schisanwilsonene A (CHEBI:66432) is a diol (CHEBI:23824) |
| schisanwilsonene A (CHEBI:66432) is a primary alcohol (CHEBI:15734) |
| schisanwilsonene A (CHEBI:66432) is a sesquiterpenoid (CHEBI:26658) |
| schisanwilsonene A (CHEBI:66432) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 2-[(1R,3aS,8aR)-6-(hydroxymethyl)-3a-methyl-1,2,3,3a,4,5,8,8a-octahydroazulen-1-yl]propan-2-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19717048 | Reaxys |
| Citations |
|---|