EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H42O6 |
| Net Charge | 0 |
| Average Mass | 522.682 |
| Monoisotopic Mass | 522.29814 |
| SMILES | [H][C@]1([C@](C)(OC(C)=O)[C@]2([H])OC(=O)C3CC2C3)CC[C@@]2(C)C3=C(C=C4C=CC(=O)OC(C)(C)[C@]4([H])CC3)CC[C@]12C |
| InChI | InChI=1S/C32H42O6/c1-18(33)37-32(6,27-21-16-22(17-21)28(35)36-27)25-12-14-30(4)24-9-8-23-19(7-10-26(34)38-29(23,2)3)15-20(24)11-13-31(25,30)5/h7,10,15,21-23,25,27H,8-9,11-14,16-17H2,1-6H3/t21?,22?,23-,25+,27-,30+,31-,32+/m1/s1 |
| InChIKey | XVPNHPJRBZKAFN-ABHCLWBLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schisandra henryi (ncbitaxon:124789) | stem (BTO:0001300) | PubMed (14661856) | |
| Schisandra propinqua (ncbitaxon:124790) | stem (BTO:0001300) | DOI (10.1002/cjoc.20010190319) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| schiprolactone A (CHEBI:66430) has role antineoplastic agent (CHEBI:35610) |
| schiprolactone A (CHEBI:66430) has role metabolite (CHEBI:25212) |
| schiprolactone A (CHEBI:66430) is a acetate ester (CHEBI:47622) |
| schiprolactone A (CHEBI:66430) is a lactone (CHEBI:25000) |
| schiprolactone A (CHEBI:66430) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (1S)-1-[(2R)-4-oxo-3-oxabicyclo[3.1.1]hept-2-yl]-1-[(3S,3aR,11aR,13bR)-3a,11,11,13b-tetramethyl-9-oxo-1,2,3,3a,4,5,9,11,11a,12,13,13b-dodecahydroindeno[5',4':4,5]cyclohepta[1,2-c]oxepin-3-yl]ethyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9743998 | Reaxys |
| Citations |
|---|