EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O4 |
| Net Charge | 0 |
| Average Mass | 358.478 |
| Monoisotopic Mass | 358.21441 |
| SMILES | CC(C)=CCC[C@]1(C)Oc2c(CC=C(C)C)cc(C(=O)O)cc2C[C@@H]1O |
| InChI | InChI=1S/C22H30O4/c1-14(2)7-6-10-22(5)19(23)13-17-12-18(21(24)25)11-16(20(17)26-22)9-8-15(3)4/h7-8,11-12,19,23H,6,9-10,13H2,1-5H3,(H,24,25)/t19-,22-/m0/s1 |
| InChIKey | BZURYTKOXWYRAG-UGKGYDQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myrsine seguinii (ncbitaxon:276780) | |||
| leaf (BTO:0000713) | PubMed (12005065) | fresh leaves and twigs | |
| twig (BTO:0001411) | PubMed (12005065) | fresh leaves and twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 4.4.1.11 (methionine gamma-lyase) inhibitor An EC 4.4.1.* (C‒S lyase) inhibitor that interferes with the action of the enzyme methionine γ-lyase (EC 4.4.1.11). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myrsinoic acid C (CHEBI:66428) has role anti-inflammatory agent (CHEBI:67079) |
| myrsinoic acid C (CHEBI:66428) has role EC 4.4.1.11 (methionine γ-lyase) inhibitor (CHEBI:73196) |
| myrsinoic acid C (CHEBI:66428) has role metabolite (CHEBI:25212) |
| myrsinoic acid C (CHEBI:66428) is a chromanes (CHEBI:23230) |
| myrsinoic acid C (CHEBI:66428) is a monocarboxylic acid (CHEBI:25384) |
| myrsinoic acid C (CHEBI:66428) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2S,3S)-3-hydroxy-2-methyl-8-(3-methylbut-2-en-1-yl)-2-(4-methylpent-3-en-1-yl)-3,4-dihydro-2H-chromene-6-carboxylic acid |
| Synonym | Source |
|---|---|
| (2S),(3S)-6-carboxy-2,3-dihydro-3-hydroxy-2-methyl-2-(4'-methylpenta-3'-enyl)-8-(3''-methyl-2''-butenyl)chroman | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN101495127 | Patent |
| KR20090035605 | Patent |
| US2010069477 | Patent |
| WO2008013062 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9291057 | Reaxys |
| Citations |
|---|