EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O3 |
| Net Charge | 0 |
| Average Mass | 342.479 |
| Monoisotopic Mass | 342.21949 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(C(=O)O)cc(CC=C(C)C)c1O |
| InChI | InChI=1S/C22H30O3/c1-15(2)7-6-8-17(5)10-12-19-14-20(22(24)25)13-18(21(19)23)11-9-16(3)4/h7,9-10,13-14,23H,6,8,11-12H2,1-5H3,(H,24,25)/b17-10+ |
| InChIKey | SUXGLLRPXXXJER-LICLKQGHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myrsine seguinii (ncbitaxon:276780) | |||
| twig (BTO:0001411) | PubMed (12005065) | fresh leaves and twigs | |
| leaf (BTO:0000713) | PubMed (12005065) | fresh leaves and twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 4.4.1.11 (methionine gamma-lyase) inhibitor An EC 4.4.1.* (C‒S lyase) inhibitor that interferes with the action of the enzyme methionine γ-lyase (EC 4.4.1.11). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myrsinoic acid A (CHEBI:66426) has role anti-inflammatory agent (CHEBI:67079) |
| myrsinoic acid A (CHEBI:66426) has role antineoplastic agent (CHEBI:35610) |
| myrsinoic acid A (CHEBI:66426) has role EC 4.4.1.11 (methionine γ-lyase) inhibitor (CHEBI:73196) |
| myrsinoic acid A (CHEBI:66426) has role metabolite (CHEBI:25212) |
| myrsinoic acid A (CHEBI:66426) is a monohydroxybenzoic acid (CHEBI:25389) |
| IUPAC Name |
|---|
| 3-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-4-hydroxy-5-(3-methylbut-2-en-1-yl)benzoic acid |
| Synonym | Source |
|---|---|
| 3-geranyl-4-hydroxy-5-(3'-methyl-2'-butenyl)benzoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN101495127 | Patent |
| KR20090035605 | Patent |
| US2010069477 | Patent |
| US2011060047 | Patent |
| WO2008013062 | Patent |
| WO2011014257 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20135097 | Reaxys |
| Citations |
|---|