EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO3 |
| Net Charge | 0 |
| Average Mass | 167.164 |
| Monoisotopic Mass | 167.05824 |
| SMILES | C=C[C@]1(O)CC(NC=O)=CC1=O |
| InChI | InChI=1S/C8H9NO3/c1-2-8(12)4-6(9-5-10)3-7(8)11/h2-3,5,12H,1,4H2,(H,9,10)/t8-/m0/s1 |
| InChIKey | PGQRZOUYTNKEBE-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myrothecium (ncbitaxon:5531) | - | PubMed (15802853) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myrothenone A (CHEBI:66424) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| myrothenone A (CHEBI:66424) has role metabolite (CHEBI:25212) |
| myrothenone A (CHEBI:66424) is a alicyclic ketone (CHEBI:36132) |
| myrothenone A (CHEBI:66424) is a formamides (CHEBI:24079) |
| myrothenone A (CHEBI:66424) is a tertiary alcohol (CHEBI:26878) |
| myrothenone A (CHEBI:66424) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| N-[(4R)-4-ethenyl-4-hydroxy-3-oxocyclopent-1-en-1-yl]formamide |
| Synonyms | Source |
|---|---|
| (5R)-5-ethenyl-3-formamido-5-hydroxy-2-cyclopenten-1-one | ChEBI |
| N-[(4R)-4-hydroxy-3-oxo-4-vinylcyclopent-1-en-1-yl]formamide | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10064379 | Reaxys |
| Citations |
|---|