EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O7 |
| Net Charge | 0 |
| Average Mass | 372.458 |
| Monoisotopic Mass | 372.21480 |
| SMILES | [H][C@@]1(C(=O)[C@H](CO)[C@H](O)[C@@]2(C)O[C@]2([H])[C@@H](C)/C=C\C)COC(O)(CC)C[C@@H]1O |
| InChI | InChI=1S/C19H32O7/c1-5-7-11(3)17-18(4,26-17)16(23)12(9-20)15(22)13-10-25-19(24,6-2)8-14(13)21/h5,7,11-14,16-17,20-21,23-24H,6,8-10H2,1-4H3/b7-5-/t11-,12-,13+,14-,16-,17+,18+,19?/m0/s1 |
| InChIKey | VJPJOSSWTOMULO-UGGJLBIYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myriapora truncata (WORMS:111435) | - | PubMed (17284072) | Myriaporone 3(hemiketal) and Myriaporone 4(hydroxy ketone)s are mixture of isomer with ratio 3:1 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myriaporone 3 (CHEBI:66422) has functional parent polyketide (CHEBI:26188) |
| myriaporone 3 (CHEBI:66422) has role antineoplastic agent (CHEBI:35610) |
| myriaporone 3 (CHEBI:66422) has role metabolite (CHEBI:25212) |
| myriaporone 3 (CHEBI:66422) is a epoxide (CHEBI:32955) |
| myriaporone 3 (CHEBI:66422) is a lactol (CHEBI:38131) |
| myriaporone 3 (CHEBI:66422) is a oxanes (CHEBI:46942) |
| myriaporone 3 (CHEBI:66422) is a primary alcohol (CHEBI:15734) |
| myriaporone 3 (CHEBI:66422) is a secondary alcohol (CHEBI:35681) |
| myriaporone 3 (CHEBI:66422) is a β-hydroxy ketone (CHEBI:55380) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9732280 | Reaxys |
| Citations |
|---|