EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H40N2O6 |
| Net Charge | 0 |
| Average Mass | 596.724 |
| Monoisotopic Mass | 596.28864 |
| SMILES | COc1cc2c(cc1O)C(Cc1ccc(Oc3cc(CC4c5cc(O)c(OC)cc5CCN4C)ccc3O)cc1)N(C)CC2 |
| InChI | InChI=1S/C36H40N2O6/c1-37-13-11-24-18-34(42-3)32(40)20-27(24)29(37)15-22-5-8-26(9-6-22)44-36-17-23(7-10-31(36)39)16-30-28-21-33(41)35(43-4)19-25(28)12-14-38(30)2/h5-10,17-21,29-30,39-41H,11-16H2,1-4H3 |
| InChIKey | FDABVSXGAMFQQH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Magnoline (CHEBI:6642) is a bisbenzylisoquinoline alkaloid (CHEBI:133004) |
| Magnoline (CHEBI:6642) is a isoquinolines (CHEBI:24922) |
| Synonym | Source |
|---|---|
| Magnoline | KEGG COMPOUND |