EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O |
| Net Charge | 0 |
| Average Mass | 264.368 |
| Monoisotopic Mass | 264.15142 |
| SMILES | Cc1ccc2c(ccc3cc(C(C)C)c(O)cc32)c1C |
| InChI | InChI=1S/C19H20O/c1-11(2)17-9-14-6-8-15-13(4)12(3)5-7-16(15)18(14)10-19(17)20/h5-11,20H,1-4H3 |
| InChIKey | ZMSKUQUFEKLXGK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia multicaulis (IPNI:456747-1) | root (BTO:0001188) | PubMed (9428161) |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-demethylmulticaulin (CHEBI:66408) has role antitubercular agent (CHEBI:33231) |
| 12-demethylmulticaulin (CHEBI:66408) has role metabolite (CHEBI:25212) |
| 12-demethylmulticaulin (CHEBI:66408) is a diterpenoid (CHEBI:23849) |
| 12-demethylmulticaulin (CHEBI:66408) is a phenanthrenes (CHEBI:25961) |
| 12-demethylmulticaulin (CHEBI:66408) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 7,8-dimethyl-2-propan-2-ylphenanthren-3-ol |
| Synonym | Source |
|---|---|
| 12-hydroxy-abieta-1,3,5(10),6,8,11,13-heptaene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7873031 | Reaxys |
| Citations |
|---|