EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O |
| Net Charge | 0 |
| Average Mass | 264.368 |
| Monoisotopic Mass | 264.15142 |
| SMILES | Cc1ccc2c(ccc3cc(C(C)C)c(O)cc32)c1C |
| InChI | InChI=1S/C19H20O/c1-11(2)17-9-14-6-8-15-13(4)12(3)5-7-16(15)18(14)10-19(17)20/h5-11,20H,1-4H3 |
| InChIKey | ZMSKUQUFEKLXGK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia multicaulis (IPNI:456747-1) | root (BTO:0001188) | PubMed (9428161) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-demethylmulticaulin (CHEBI:66408) has role antitubercular agent (CHEBI:33231) |
| 12-demethylmulticaulin (CHEBI:66408) has role metabolite (CHEBI:25212) |
| 12-demethylmulticaulin (CHEBI:66408) is a diterpenoid (CHEBI:23849) |
| 12-demethylmulticaulin (CHEBI:66408) is a phenanthrenes (CHEBI:25961) |
| 12-demethylmulticaulin (CHEBI:66408) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 7,8-dimethyl-2-propan-2-ylphenanthren-3-ol |
| Synonym | Source |
|---|---|
| 12-hydroxy-abieta-1,3,5(10),6,8,11,13-heptaene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7873031 | Reaxys |
| Citations |
|---|