EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O |
| Net Charge | 0 |
| Average Mass | 278.395 |
| Monoisotopic Mass | 278.16707 |
| SMILES | COc1cc2c(ccc3c(C)c(C)ccc32)cc1C(C)C |
| InChI | InChI=1S/C20H22O/c1-12(2)18-10-15-7-9-16-14(4)13(3)6-8-17(16)19(15)11-20(18)21-5/h6-12H,1-5H3 |
| InChIKey | QSZDTCGHFRXGFB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia multicaulis (IPNI:456747-1) | root (BTO:0001188) | PubMed (9428161) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| multicaulin (CHEBI:66407) has role antitubercular agent (CHEBI:33231) |
| multicaulin (CHEBI:66407) has role metabolite (CHEBI:25212) |
| multicaulin (CHEBI:66407) is a aromatic ether (CHEBI:35618) |
| multicaulin (CHEBI:66407) is a diterpenoid (CHEBI:23849) |
| multicaulin (CHEBI:66407) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 6-methoxy-1,2-dimethyl-7-(propan-2-yl)phenanthrene |
| Synonyms | Source |
|---|---|
| 12-methoxy-abieta-1,3,5(10),6,8,11,13-heptaene | ChEBI |
| 7,8-dimethyl-2-(propan-2-yl)phenanthren-3-yl methyl ether | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7874294 | Reaxys |
| Citations |
|---|