EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25Br2NO3 |
| Net Charge | 0 |
| Average Mass | 439.188 |
| Monoisotopic Mass | 437.02012 |
| SMILES | O=C(O)CNC(=O)/C=C/CCCCCCCCCC=C(Br)Br |
| InChI | InChI=1S/C16H25Br2NO3/c17-14(18)11-9-7-5-3-1-2-4-6-8-10-12-15(20)19-13-16(21)22/h10-12H,1-9,13H2,(H,19,20)(H,21,22)/b12-10+ |
| InChIKey | ZLIHRGDEFDFVOK-ZRDIBKRKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Siliquariaspongia (WORMS:171246) | - | PubMed (19191563) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| motualevic acid A (CHEBI:66405) has role antibacterial agent (CHEBI:33282) |
| motualevic acid A (CHEBI:66405) has role metabolite (CHEBI:25212) |
| motualevic acid A (CHEBI:66405) is a N-acylglycine (CHEBI:16180) |
| motualevic acid A (CHEBI:66405) is a enamide (CHEBI:51751) |
| motualevic acid A (CHEBI:66405) is a fatty amide (CHEBI:29348) |
| motualevic acid A (CHEBI:66405) is a monocarboxylic acid (CHEBI:25384) |
| motualevic acid A (CHEBI:66405) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| N-[(2E)-14,14-dibromotetradeca-2,13-dienoyl]glycine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19364086 | Reaxys |
| Citations |
|---|