EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H46O14 |
| Net Charge | 0 |
| Average Mass | 786.827 |
| Monoisotopic Mass | 786.28876 |
| SMILES | [H][C@]1(O[C@H]2CC[C@H](O[C@@]3(C)CC(=O)c4c(ccc5c4C(=O)c4ccc([C@H]6C[C@@]7([H])O[C@@]8([H])CC(=O)[C@H](C)O[C@@]8([H])O[C@]7([H])[C@@H](C)O6)c(O)c4C5=O)C3)O[C@H]2C)C=CC(=O)[C@H](C)O1 |
| InChI | InChI=1S/C43H46O14/c1-18-26(44)10-12-33(51-18)55-29-11-13-34(52-20(29)3)57-43(5)16-22-6-7-24-36(35(22)28(46)17-43)39(48)25-9-8-23(38(47)37(25)40(24)49)30-15-31-41(21(4)50-30)56-42-32(54-31)14-27(45)19(2)53-42/h6-10,12,18-21,29-34,41-42,47H,11,13-17H2,1-5H3/t18-,19-,20-,21+,29-,30+,31+,32-,33-,34-,41+,42-,43+/m0/s1 |
| InChIKey | YXQYFVURWVZIMD-CZMJNFCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (18666798) | Strain: KY002 |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moromycin A (CHEBI:66403) has functional parent tetrangomycin (CHEBI:32211) |
| moromycin A (CHEBI:66403) has role antineoplastic agent (CHEBI:35610) |
| moromycin A (CHEBI:66403) is a C-glycosyl compound (CHEBI:20857) |
| moromycin A (CHEBI:66403) is a angucycline antibiotic (CHEBI:70737) |
| moromycin A (CHEBI:66403) is a glycoside (CHEBI:24400) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19172515 | Reaxys |
| Citations |
|---|