EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | CC(C)=CCOc1ccc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)cc1O |
| InChI | InChI=1S/C20H20O6/c1-11(2)5-6-25-17-4-3-12(7-14(17)22)18-10-16(24)20-15(23)8-13(21)9-19(20)26-18/h3-5,7-9,18,21-23H,6,10H2,1-2H3/t18-/m0/s1 |
| InChIKey | UIFXCAYUHZVWHR-SFHVURJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monotes engleri (IPNI:321075-1) | leaf (BTO:0000713) | DOI (10.1002/hlca.19980810325) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monotesone A (CHEBI:66400) has functional parent (2S)-flavanone (CHEBI:15606) |
| monotesone A (CHEBI:66400) has role antifungal agent (CHEBI:35718) |
| monotesone A (CHEBI:66400) has role metabolite (CHEBI:25212) |
| monotesone A (CHEBI:66400) is a 3'-hydroxyflavanones (CHEBI:48024) |
| monotesone A (CHEBI:66400) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-{3-hydroxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7,3'-trihydroxy-4'-O-prenylflavanone | ChEBI |
| (2S)-2,3-dihydro-5,7-dihydroxy-2-[3-hydroxy-4-[(3-methylbut-2-enyl)oxy]phenyl]-4H-1-benzopyran-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140406 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8011731 | Reaxys |
| Citations |
|---|