EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | [H][C@@]12C(=O)c3c(O)cc(OC)cc3O[C@]1(C)[C@@H](O)[C@@H](C)C[C@@H]2O |
| InChI | InChI=1S/C16H20O6/c1-7-4-10(18)13-14(19)12-9(17)5-8(21-3)6-11(12)22-16(13,2)15(7)20/h5-7,10,13,15,17-18,20H,4H2,1-3H3/t7-,10-,13+,15-,16-/m0/s1 |
| InChIKey | PIJNYABFKNAKHE-YZKPXJPOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monodictys putredinis (WORMS:100530) | - | PubMed (17291041) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monodictysin C (CHEBI:66399) has role antineoplastic agent (CHEBI:35610) |
| monodictysin C (CHEBI:66399) has role metabolite (CHEBI:25212) |
| monodictysin C (CHEBI:66399) is a aromatic ether (CHEBI:35618) |
| monodictysin C (CHEBI:66399) is a phenols (CHEBI:33853) |
| monodictysin C (CHEBI:66399) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,3S,4S,4aS,9aS)-1,4,8-trihydroxy-6-methoxy-3,4a-dimethyl-1,2,3,4,4a,9a-hexahydro-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11058829 | Reaxys |
| Citations |
|---|