EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O5 |
| Net Charge | 0 |
| Average Mass | 278.304 |
| Monoisotopic Mass | 278.11542 |
| SMILES | [H][C@@]12C(=O)c3c(O)cccc3O[C@]1(C)[C@@H](O)[C@@H](C)C[C@@H]2O |
| InChI | InChI=1S/C15H18O5/c1-7-6-9(17)12-13(18)11-8(16)4-3-5-10(11)20-15(12,2)14(7)19/h3-5,7,9,12,14,16-17,19H,6H2,1-2H3/t7-,9-,12+,14-,15-/m0/s1 |
| InChIKey | NFHLHXVIHBGFKO-XHOOZROUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monodictys putredinis (WORMS:100530) | - | PubMed (17291041) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monodictysin B (CHEBI:66398) has role antineoplastic agent (CHEBI:35610) |
| monodictysin B (CHEBI:66398) has role metabolite (CHEBI:25212) |
| monodictysin B (CHEBI:66398) is a phenols (CHEBI:33853) |
| monodictysin B (CHEBI:66398) is a secondary alcohol (CHEBI:35681) |
| monodictysin B (CHEBI:66398) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (1S,3S,4S,4aS,9aS)-1,4,8-trihydroxy-3,4a-dimethyl-1,2,3,4,4a,9a-hexahydro-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11058828 | Reaxys |
| Citations |
|---|