EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | [H][C@@]12CC[C@@]3([H])C(=C)C(=O)[C@]1([C@H](O)C[C@]1([H])C(C)(C)[C@@H](O)C[C@H](O)[C@@]21C)[C@@H]3O |
| InChI | InChI=1S/C20H30O5/c1-9-10-5-6-11-19(4)12(18(2,3)13(21)8-14(19)22)7-15(23)20(11,16(9)24)17(10)25/h10-15,17,21-23,25H,1,5-8H2,2-4H3/t10-,11-,12+,13-,14-,15+,17+,19-,20-/m0/s1 |
| InChIKey | FURKNFFYNZCRQG-AMIFZCDKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon henryi (IPNI:448579-1) | leaf (BTO:0000713) | PubMed (19031362) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minheryin G (CHEBI:66394) has role antineoplastic agent (CHEBI:35610) |
| minheryin G (CHEBI:66394) has role metabolite (CHEBI:25212) |
| minheryin G (CHEBI:66394) is a ent-kaurane diterpenoid (CHEBI:36760) |
| minheryin G (CHEBI:66394) is a bridged compound (CHEBI:35990) |
| minheryin G (CHEBI:66394) is a cyclic ketone (CHEBI:3992) |
| minheryin G (CHEBI:66394) is a secondary alcohol (CHEBI:35681) |
| minheryin G (CHEBI:66394) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (1α,3β,5β,7α,8α,9β,10α,13α,14R)-1,3,7,14-tetrahydroxykaur-16-en-15-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21137669 | Reaxys |
| Citations |
|---|