EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O3 |
| Net Charge | 0 |
| Average Mass | 258.317 |
| Monoisotopic Mass | 258.12559 |
| SMILES | CO[C@@H]1CC(=O)C=CC[C@@]1(O)/C=C\c1ccccc1 |
| InChI | InChI=1S/C16H18O3/c1-19-15-12-14(17)8-5-10-16(15,18)11-9-13-6-3-2-4-7-13/h2-9,11,15,18H,10,12H2,1H3/b11-9-/t15-,16-/m1/s1 |
| InChIKey | FLWCMQWIFOAMFR-LXJJZASNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aeschynomene mimosifolia (IPNI:472828-1) | xylem (BTO:0001468) | PubMed (8991952) | Previous component: root wood; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mimosifolenone (CHEBI:66393) has role metabolite (CHEBI:25212) |
| mimosifolenone (CHEBI:66393) is a cyclic ketone (CHEBI:3992) |
| mimosifolenone (CHEBI:66393) is a enone (CHEBI:51689) |
| mimosifolenone (CHEBI:66393) is a ether (CHEBI:25698) |
| mimosifolenone (CHEBI:66393) is a styrenes (CHEBI:26799) |
| mimosifolenone (CHEBI:66393) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (5R,6R)-5-hydroxy-6-methoxy-5-[(Z)-2-phenylethenyl]cyclohept-2-en-1-one |
| Citations |
|---|