EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O7 |
| Net Charge | 0 |
| Average Mass | 438.476 |
| Monoisotopic Mass | 438.16785 |
| SMILES | C=C(C)C(O)Cc1c(O)c(CC=C(C)C)c2occ(-c3ccc(O)c(O)c3)c(=O)c2c1O |
| InChI | InChI=1S/C25H26O7/c1-12(2)5-7-15-22(29)16(10-19(27)13(3)4)23(30)21-24(31)17(11-32-25(15)21)14-6-8-18(26)20(28)9-14/h5-6,8-9,11,19,26-30H,3,7,10H2,1-2,4H3 |
| InChIKey | FSQKKJIBNQATIX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Millettia pachycarpa (ncbitaxon:690557) | leaf (BTO:0000713) | PubMed (16441086) | 10:11 Enantiomeric mixture |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| millewanin G (CHEBI:66391) has role anti-estrogen (CHEBI:50751) |
| millewanin G (CHEBI:66391) has role plant metabolite (CHEBI:76924) |
| millewanin G (CHEBI:66391) is a 7-hydroxyisoflavones (CHEBI:55465) |
| millewanin G (CHEBI:66391) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-(2-hydroxy-3-methylbut-3-en-1-yl)-8-(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18586900 | Reaxys |
| Citations |
|---|