EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39NO7 |
| Net Charge | 0 |
| Average Mass | 489.609 |
| Monoisotopic Mass | 489.27265 |
| SMILES | [H][C@]1([C@H](C)C(=O)CCCC2CC(=O)NC(=O)C2)OC(=O)/C=C/CC/C=C/[C@H](OC)[C@@H](O)[C@H](C)/C=C\1C |
| InChI | InChI=1S/C27H39NO7/c1-17-14-18(2)27(35-25(32)13-8-6-5-7-12-22(34-4)26(17)33)19(3)21(29)11-9-10-20-15-23(30)28-24(31)16-20/h7-8,12-14,17,19-20,22,26-27,33H,5-6,9-11,15-16H2,1-4H3,(H,28,30,31)/b12-7+,13-8+,18-14-/t17-,19-,22+,26+,27+/m1/s1 |
| InChIKey | OGYMUMAKGYYNHV-IJMHZYIBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (11132958) | Strain: MK929-43F1 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| migrastatin (CHEBI:66389) has role antineoplastic agent (CHEBI:35610) |
| migrastatin (CHEBI:66389) has role metabolite (CHEBI:25212) |
| migrastatin (CHEBI:66389) is a ether (CHEBI:25698) |
| migrastatin (CHEBI:66389) is a macrolide antibiotic (CHEBI:25105) |
| migrastatin (CHEBI:66389) is a piperidones (CHEBI:48589) |
| migrastatin (CHEBI:66389) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 4-{(5S)-5-[(2R,3Z,5R,6S,7S,8E,12E)-6-hydroxy-7-methoxy-3,5-dimethyl-14-oxooxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohexyl}piperidine-2,6-dione |
| Synonym | Source |
|---|---|
| (+)-migrastatin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| JP2008273981 | Patent |
| US2009124662 | Patent |
| US7375230 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9238488 | Reaxys |
| CAS:314245-65-3 | ChemIDplus |
| Citations |
|---|