EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@@]12O[C@]1(C)/C=C/C(=O)/C(C)=C/[C@@]1([H])C(C)(C)[C@@]1([H])CC[C@H](C)CC2=O |
| InChI | InChI=1S/C20H28O3/c1-12-6-7-14-15(19(14,3)4)11-13(2)16(21)8-9-20(5)18(23-20)17(22)10-12/h8-9,11-12,14-15,18H,6-7,10H2,1-5H3/b9-8+,13-11+/t12-,14-,15+,18-,20+/m0/s1 |
| InChIKey | XMAKUNDAGAVHGP-XWUHLNSPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinularia microclavata (WORMS:288550) | - | PubMed (16038555) |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| microclavatin (CHEBI:66387) has role antineoplastic agent (CHEBI:35610) |
| microclavatin (CHEBI:66387) has role coral metabolite (CHEBI:76498) |
| microclavatin (CHEBI:66387) is a diterpenoid (CHEBI:23849) |
| microclavatin (CHEBI:66387) is a enone (CHEBI:51689) |
| microclavatin (CHEBI:66387) is a epoxide (CHEBI:32955) |
| microclavatin (CHEBI:66387) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (1R,2E,5E,7R,9R,12S,15S)-3,7,12,16,16-pentamethyl-8-oxatricyclo[13.1.0.07,9]hexadeca-2,5-diene-4,10-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15769435 | Reaxys |
| Citations |
|---|