EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O8 |
| Net Charge | 0 |
| Average Mass | 450.528 |
| Monoisotopic Mass | 450.22537 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]1([H])[C@H](OC(C)=O)C/C(C)=C/CC/C(C)=C/C[C@@H](OC(C)=O)[C@](C)(O)[C@H]2O |
| InChI | InChI=1S/C24H34O8/c1-13-8-7-9-14(2)12-18(30-16(4)25)20-15(3)23(28)32-21(20)22(27)24(6,29)19(11-10-13)31-17(5)26/h9-10,18-22,27,29H,3,7-8,11-12H2,1-2,4-6H3/b13-10+,14-9+/t18-,19-,20-,21+,22+,24+/m1/s1 |
| InChIKey | IQBWQYJKNHZZBD-MXWKRVGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lobophytum michaelae (WORMS:288797) | - | PubMed (17473465) |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| michaolide K (CHEBI:66384) has role antineoplastic agent (CHEBI:35610) |
| michaolide K (CHEBI:66384) has role coral metabolite (CHEBI:76498) |
| michaolide K (CHEBI:66384) is a acetate ester (CHEBI:47622) |
| michaolide K (CHEBI:66384) is a cembrane diterpenoid (CHEBI:60687) |
| michaolide K (CHEBI:66384) is a macrocycle (CHEBI:51026) |
| michaolide K (CHEBI:66384) is a secondary alcohol (CHEBI:35681) |
| michaolide K (CHEBI:66384) is a tertiary alcohol (CHEBI:26878) |
| michaolide K (CHEBI:66384) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4R,6E,10E,13R,14R,15S,15aS)-14,15-dihydroxy-6,10,14-trimethyl-3-methylidene-2-oxo-2,3,3a,4,5,8,9,12,13,14,15,15a-dodecahydrocyclotetradeca[b]furan-4,13-diyl diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11101581 | Reaxys |
| Citations |
|---|