EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O11 |
| Net Charge | 0 |
| Average Mass | 550.601 |
| Monoisotopic Mass | 550.24141 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]1([H])[C@H](OC(C)=O)C/C(C)=C/C[C@H](OC(C)=O)/C(C)=C/C[C@@H](OC(C)=O)[C@](C)(O)[C@H]2OC(C)=O |
| InChI | InChI=1S/C28H38O11/c1-14-9-11-21(35-17(4)29)15(2)10-12-23(37-19(6)31)28(8,34)26(38-20(7)32)25-24(16(3)27(33)39-25)22(13-14)36-18(5)30/h9-10,21-26,34H,3,11-13H2,1-2,4-8H3/b14-9+,15-10+/t21-,22+,23+,24+,25-,26-,28-/m0/s1 |
| InChIKey | FFMDUIKBNZDKNL-LXGVGBMYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lobophytum michaelae (WORMS:288797) | - | PubMed (17473465) |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| michaolide J (CHEBI:66383) has role antineoplastic agent (CHEBI:35610) |
| michaolide J (CHEBI:66383) has role coral metabolite (CHEBI:76498) |
| michaolide J (CHEBI:66383) is a acetate ester (CHEBI:47622) |
| michaolide J (CHEBI:66383) is a cembrane diterpenoid (CHEBI:60687) |
| michaolide J (CHEBI:66383) is a macrocycle (CHEBI:51026) |
| michaolide J (CHEBI:66383) is a tertiary alcohol (CHEBI:26878) |
| michaolide J (CHEBI:66383) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4R,6E,9S,10E,13R,14S,15S,15aS)-14-hydroxy-6,10,14-trimethyl-3-methylidene-2-oxo-2,3,3a,4,5,8,9,12,13,14,15,15a-dodecahydrocyclotetradeca[b]furan-4,9,13,15-tetrayl tetraacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11101580 | Reaxys |
| Citations |
|---|