EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38O10 |
| Net Charge | 0 |
| Average Mass | 522.591 |
| Monoisotopic Mass | 522.24650 |
| SMILES | [H][C@]12[C@H](COC)C(=O)O[C@]1([H])[C@]1([H])O[C@@]1(C)[C@H](OC(C)=O)C/C=C(\C)[C@@H](OC(C)=O)C/C=C(\C)C[C@H]2OC(C)=O |
| InChI | InChI=1S/C27H38O10/c1-14-8-10-20(33-16(3)28)15(2)9-11-22(35-18(5)30)27(6)25(37-27)24-23(21(12-14)34-17(4)29)19(13-32-7)26(31)36-24/h8-9,19-25H,10-13H2,1-7H3/b14-8+,15-9+/t19-,20-,21+,22+,23+,24-,25-,27-/m0/s1 |
| InChIKey | OCEBYVKMYIOKNW-ZPWOZIFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lobophytum michaelae (WORMS:288797) | - | PubMed (17473465) |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| michaolide H (CHEBI:66381) has role antineoplastic agent (CHEBI:35610) |
| michaolide H (CHEBI:66381) has role coral metabolite (CHEBI:76498) |
| michaolide H (CHEBI:66381) is a acetate ester (CHEBI:47622) |
| michaolide H (CHEBI:66381) is a cembrane diterpenoid (CHEBI:60687) |
| michaolide H (CHEBI:66381) is a epoxide (CHEBI:32955) |
| michaolide H (CHEBI:66381) is a macrocycle (CHEBI:51026) |
| michaolide H (CHEBI:66381) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (1aS,1bS,4R,4aR,5R,7E,10S,11E,14R,14aS)-4-(methoxymethyl)-7,11,14a-trimethyl-3-oxo-1a,1b,3,4,4a,5,6,9,10,13,14,14a-dodecahydrooxireno[13,14]cyclotetradeca[1,2-b]furan-5,10,14-triyl triacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11101592 | Reaxys |
| Citations |
|---|