EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O8 |
| Net Charge | 0 |
| Average Mass | 446.496 |
| Monoisotopic Mass | 446.19407 |
| SMILES | [H][C@@]12O[C@@]1(C)[C@H](OC(C)=O)C/C=C(\C)C(=O)C/C=C(\C)C[C@@H](OC(C)=O)[C@@]1([H])C(=C)C(=O)O[C@]21[H] |
| InChI | InChI=1S/C24H30O8/c1-12-7-9-17(27)13(2)8-10-19(30-16(5)26)24(6)22(32-24)21-20(14(3)23(28)31-21)18(11-12)29-15(4)25/h7-8,18-22H,3,9-11H2,1-2,4-6H3/b12-7+,13-8+/t18-,19-,20-,21+,22+,24+/m1/s1 |
| InChIKey | JNBMVQUUSKZDNU-FIBYYQDESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lobophytum michaelae (WORMS:288797) | - | PubMed (17473465) |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| michaolide D (CHEBI:66377) has role antineoplastic agent (CHEBI:35610) |
| michaolide D (CHEBI:66377) has role coral metabolite (CHEBI:76498) |
| michaolide D (CHEBI:66377) is a acetate ester (CHEBI:47622) |
| michaolide D (CHEBI:66377) is a cembrane diterpenoid (CHEBI:60687) |
| michaolide D (CHEBI:66377) is a cyclic terpene ketone (CHEBI:36130) |
| michaolide D (CHEBI:66377) is a epoxide (CHEBI:32955) |
| michaolide D (CHEBI:66377) is a macrocycle (CHEBI:51026) |
| michaolide D (CHEBI:66377) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (1aS,1bS,4aR,5R,7E,11E,14R,14aS)-7,11,14a-trimethyl-4-methylidene-3,10-dioxo-1a,1b,3,4,4a,5,6,9,10,13,14,14a-dodecahydrooxireno[13,14]cyclotetradeca[1,2-b]furan-5,14-diyl diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11101588 | Reaxys |
| Citations |
|---|