EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O13 |
| Net Charge | 0 |
| Average Mass | 500.453 |
| Monoisotopic Mass | 500.15299 |
| SMILES | Cc1cc(=O)c2c(O)cc(O[C@@H]3O[C@H](CO[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)cc2o1 |
| InChI | InChI=1S/C22H28O13/c1-7-3-10(23)14-11(24)4-9(5-12(14)32-7)34-22-20(30)18(28)16(26)13(35-22)6-31-21-19(29)17(27)15(25)8(2)33-21/h3-5,8,13,15-22,24-30H,6H2,1-2H3/t8-,13+,15-,16+,17+,18-,19+,20+,21+,22+/m0/s1 |
| InChIKey | LYGONQRLEVFULH-HLUXVQISSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crossosoma bigelovii (ncbitaxon:105808) | |||
| fruit (BTO:0000486) | PubMed (19405508) | ||
| leaf (BTO:0000713) | PubMed (19405508) | ||
| flower (BTO:0000469) | PubMed (19405508) | ||
| twig (BTO:0001411) | PubMed (19405508) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-2-methylchromone-7-O-rutinoside (CHEBI:66371) has role antineoplastic agent (CHEBI:35610) |
| 5-hydroxy-2-methylchromone-7-O-rutinoside (CHEBI:66371) has role metabolite (CHEBI:25212) |
| 5-hydroxy-2-methylchromone-7-O-rutinoside (CHEBI:66371) is a chromones (CHEBI:23238) |
| 5-hydroxy-2-methylchromone-7-O-rutinoside (CHEBI:66371) is a disaccharide derivative (CHEBI:63353) |
| 5-hydroxy-2-methylchromone-7-O-rutinoside (CHEBI:66371) is a phenols (CHEBI:33853) |
| 5-hydroxy-2-methylchromone-7-O-rutinoside (CHEBI:66371) is a rutinoside (CHEBI:26587) |
| IUPAC Name |
|---|
| 5-hydroxy-2-methyl-4-oxo-4H-chromen-7-yl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 2-methylchromone glycoside 2 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21404079 | Reaxys |
| Citations |
|---|