EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O4 |
| Net Charge | 0 |
| Average Mass | 338.403 |
| Monoisotopic Mass | 338.15181 |
| SMILES | [H][C@@]12COc3cc(OC)c(CC=C(C)C)cc3[C@]1([H])Oc1cc(O)ccc12 |
| InChI | InChI=1S/C21H22O4/c1-12(2)4-5-13-8-16-19(10-18(13)23-3)24-11-17-15-7-6-14(22)9-20(15)25-21(16)17/h4,6-10,17,21-22H,5,11H2,1-3H3/t17-,21-/m0/s1 |
| InChIKey | FZFGGNNUYSILSL-UWJYYQICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina burttii (IPNI:494372-1) | stem (BTO:0001300) | PubMed (12770595) | Previous component: stem bark; |
| Erythrina glauca (IPNI:494436-1) | bark (BTO:0001301) | PubMed (9170286) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-methylcalopocarpin (CHEBI:66369) has functional parent (6aR,11aR)-pterocarpan (CHEBI:73133) |
| 3-O-methylcalopocarpin (CHEBI:66369) has role anti-HIV agent (CHEBI:64946) |
| 3-O-methylcalopocarpin (CHEBI:66369) has role plant metabolite (CHEBI:76924) |
| 3-O-methylcalopocarpin (CHEBI:66369) is a aromatic ether (CHEBI:35618) |
| 3-O-methylcalopocarpin (CHEBI:66369) is a phenols (CHEBI:33853) |
| 3-O-methylcalopocarpin (CHEBI:66369) is a pterocarpans (CHEBI:26377) |
| IUPAC Name |
|---|
| (6aR,11aR)-3-methoxy-2-(3-methylbut-2-en-1-yl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-9-ol |
| Synonyms | Source |
|---|---|
| 9-hydroxy-3-methoxy-2-prenylpterocarpan | ChEBI |
| Orientanol B | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031633 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7945641 | Reaxys |
| Citations |
|---|