EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO3S |
| Net Charge | 0 |
| Average Mass | 237.280 |
| Monoisotopic Mass | 237.04596 |
| SMILES | C[C@]1(C(=O)O)CSC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C11H11NO3S/c1-11(10(14)15)6-16-9(12-11)7-4-2-3-5-8(7)13/h2-5,13H,6H2,1H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | OXCVIPGXPILNPT-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (9439697) | Strain: KCTC 9303 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylaeruginoic acid (CHEBI:66368) has role antineoplastic agent (CHEBI:35610) |
| 4-methylaeruginoic acid (CHEBI:66368) has role metabolite (CHEBI:25212) |
| 4-methylaeruginoic acid (CHEBI:66368) is a 1,3-thiazoles (CHEBI:38418) |
| 4-methylaeruginoic acid (CHEBI:66368) is a monocarboxylic acid (CHEBI:25384) |
| 4-methylaeruginoic acid (CHEBI:66368) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (4S)-2-(2-hydroxyphenyl)-4-methyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 10446249 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10437963 | Reaxys |
| Citations |
|---|