EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O6 |
| Net Charge | 0 |
| Average Mass | 342.347 |
| Monoisotopic Mass | 342.11034 |
| SMILES | COc1ccc2c(=O)c3c(O)cc4c(c3oc2c1O)C(C)(C)C(C)O4 |
| InChI | InChI=1S/C19H18O6/c1-8-19(2,3)14-12(24-8)7-10(20)13-15(21)9-5-6-11(23-4)16(22)17(9)25-18(13)14/h5-8,20,22H,1-4H3 |
| InChIKey | DNYSLSNXLMFTTC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia vieillardii (IPNI:428302-1) | stem (BTO:0001300) | PubMed (15104511) | Previous component: stem bark; |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-O-methyl-2-deprenylrheediaxanthone B (CHEBI:66366) has role antioxidant (CHEBI:22586) |
| 6-O-methyl-2-deprenylrheediaxanthone B (CHEBI:66366) has role metabolite (CHEBI:25212) |
| 6-O-methyl-2-deprenylrheediaxanthone B (CHEBI:66366) is a aromatic ether (CHEBI:35618) |
| 6-O-methyl-2-deprenylrheediaxanthone B (CHEBI:66366) is a cyclic ether (CHEBI:37407) |
| 6-O-methyl-2-deprenylrheediaxanthone B (CHEBI:66366) is a organic heterotetracyclic compound (CHEBI:38163) |
| 6-O-methyl-2-deprenylrheediaxanthone B (CHEBI:66366) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5,10-dihydroxy-9-methoxy-1,1,2-trimethyl-1,2-dihydro-6H-furo[2,3-c]xanthen-6-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11309214 | Reaxys |
| Citations |
|---|