EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O4 |
| Net Charge | 0 |
| Average Mass | 348.483 |
| Monoisotopic Mass | 348.23006 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)C[C@@H](C)[C@]3(CC/C(=C\C=O)O3)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C21H32O4/c1-14-13-17(24-15(2)23)18-19(3,4)9-6-10-20(18,5)21(14)11-7-16(25-21)8-12-22/h8,12,14,17-18H,6-7,9-11,13H2,1-5H3/b16-8+/t14-,17-,18+,20+,21-/m1/s1 |
| InChIKey | DTODGYVUKUZPTH-FWVSRRSQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitex trifolia (ncbitaxon:204215) | fruit (BTO:0000486) | PubMed (15577254) | Dried fruits |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vitex norditerpenoid 2 (CHEBI:66363) has role metabolite (CHEBI:25212) |
| Vitex norditerpenoid 2 (CHEBI:66363) is a oxolanes (CHEBI:26912) |
| Synonym | Source |
|---|---|
| [(1R,3R,4R,4aS,5'E,8aS)-3,4a,8,8-tetramethyl-5'-(2-oxoethylidene)spiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxolane]-1-yl] acetate | ChEBI |
| Citations |
|---|