EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@]3(CC/C(=C\C=O)O3)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C19H30O2/c1-14-6-7-16-17(2,3)10-5-11-18(16,4)19(14)12-8-15(21-19)9-13-20/h9,13-14,16H,5-8,10-12H2,1-4H3/b15-9+/t14-,16+,18+,19-/m1/s1 |
| InChIKey | NUOORXQOTIGTCT-ZREGWRRISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitex trifolia (ncbitaxon:204215) | fruit (BTO:0000486) | PubMed (15577254) | Dried fruits |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vitex norditerpenoid 1 (CHEBI:66362) has role metabolite (CHEBI:25212) |
| Vitex norditerpenoid 1 (CHEBI:66362) is a oxolanes (CHEBI:26912) |
| Synonym | Source |
|---|---|
| (2E)-2-[(4aS,7R,8R,8aS)-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,5'-oxolane]-2'-ylidene]acetaldehyde | ChEBI |
| Citations |
|---|