EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43N3O6 |
| Net Charge | 0 |
| Average Mass | 493.645 |
| Monoisotopic Mass | 493.31519 |
| SMILES | C=C1/C=C/C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)OC(C(C)CCCCCC)C(CCO)C(=O)N1 |
| InChI | InChI=1S/C26H43N3O6/c1-7-8-9-10-11-17(4)23-20(14-15-30)25(33)27-18(5)12-13-21(31)28-19(6)24(32)29-22(16(2)3)26(34)35-23/h12-13,16-17,19-20,22-23,30H,5,7-11,14-15H2,1-4,6H3,(H,27,33)(H,28,31)(H,29,32)/b13-12+/t17?,19-,20?,22+,23?/m0/s1 |
| InChIKey | ONGSLGFACDWAIV-OIXFFAKGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (10604756) | Strain: MI982-63F1 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vinylamycin (CHEBI:66360) has role antibacterial agent (CHEBI:33282) |
| vinylamycin (CHEBI:66360) has role antimicrobial agent (CHEBI:33281) |
| vinylamycin (CHEBI:66360) has role metabolite (CHEBI:25212) |
| vinylamycin (CHEBI:66360) is a cyclodepsipeptide (CHEBI:35213) |
| vinylamycin (CHEBI:66360) is a macrocycle (CHEBI:51026) |
| vinylamycin (CHEBI:66360) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (3R,6S,9E)-14-(2-hydroxyethyl)-3-isopropyl-6-methyl-11-methylene-15-(octan-2-yl)-1-oxa-4,7,12-triazacyclopentadec-9-ene-2,5,8,13-tetrone |
| Citations |
|---|