EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43N3O6 |
| Net Charge | 0 |
| Average Mass | 493.645 |
| Monoisotopic Mass | 493.31519 |
| SMILES | C=C1/C=C/C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)OC(C(C)CCCCCC)C(CCO)C(=O)N1 |
| InChI | InChI=1S/C26H43N3O6/c1-7-8-9-10-11-17(4)23-20(14-15-30)25(33)27-18(5)12-13-21(31)28-19(6)24(32)29-22(16(2)3)26(34)35-23/h12-13,16-17,19-20,22-23,30H,5,7-11,14-15H2,1-4,6H3,(H,27,33)(H,28,31)(H,29,32)/b13-12+/t17?,19-,20?,22+,23?/m0/s1 |
| InChIKey | ONGSLGFACDWAIV-OIXFFAKGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (10604756) | Strain: MI982-63F1 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vinylamycin (CHEBI:66360) has role antibacterial agent (CHEBI:33282) |
| vinylamycin (CHEBI:66360) has role antimicrobial agent (CHEBI:33281) |
| vinylamycin (CHEBI:66360) has role metabolite (CHEBI:25212) |
| vinylamycin (CHEBI:66360) is a cyclodepsipeptide (CHEBI:35213) |
| vinylamycin (CHEBI:66360) is a macrocycle (CHEBI:51026) |
| vinylamycin (CHEBI:66360) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (3R,6S,9E)-14-(2-hydroxyethyl)-3-isopropyl-6-methyl-11-methylene-15-(octan-2-yl)-1-oxa-4,7,12-triazacyclopentadec-9-ene-2,5,8,13-tetrone |
| Citations |
|---|