EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H30O9 |
| Net Charge | 0 |
| Average Mass | 678.693 |
| Monoisotopic Mass | 678.18898 |
| SMILES | [H][C@]12c3cc(O)cc4c3[C@@]([H])(c3cc(O)cc5c3[C@@]([H])(c3cc(O)cc(c31)O[C@@H]2c1ccc(O)cc1)[C@H](c1ccc(O)cc1)O5)[C@H](c1ccc(O)cc1)O4 |
| InChI | InChI=1S/C42H30O9/c43-22-7-1-19(2-8-22)40-37-28-13-25(46)17-32-35(28)39(42(50-32)21-5-11-24(45)12-6-21)30-15-27(48)18-33-36(30)38(29-14-26(47)16-31(49-40)34(29)37)41(51-33)20-3-9-23(44)10-4-20/h1-18,37-48H/t37-,38-,39+,40+,41+,42-/m1/s1 |
| InChIKey | KUTVNHOAKHJJFL-ZSIJVUTGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caragana (ncbitaxon:20483) | root (BTO:0001188) | PubMed (2337958) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-α-viniferin (CHEBI:66359) has functional parent resveratrol (CHEBI:27881) |
| (+)-α-viniferin (CHEBI:66359) has role anti-inflammatory agent (CHEBI:67079) |
| (+)-α-viniferin (CHEBI:66359) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| (+)-α-viniferin (CHEBI:66359) has role plant metabolite (CHEBI:76924) |
| (+)-α-viniferin (CHEBI:66359) is a 1-benzofurans (CHEBI:38830) |
| (+)-α-viniferin (CHEBI:66359) is a macrocycle (CHEBI:51026) |
| (+)-α-viniferin (CHEBI:66359) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2R,2aR,7R,7aR,12S,12aS)-2,7,12-tris(4-hydroxyphenyl)-2,2a,7,7a,12,12a-hexahydrobis[1]benzofuro[3',4':4,5,6;3'',4'':7,8,9]cyclonona[1,2,3-cd][1]benzofuran-4,9,14-triol |
| Synonym | Source |
|---|---|
| α-viniferin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Alpha-Viniferin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3644570 | Reaxys |
| CAS:62218-13-7 | ChemIDplus |
| Citations |
|---|