EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H30O9 |
| Net Charge | 0 |
| Average Mass | 678.693 |
| Monoisotopic Mass | 678.18898 |
| SMILES | [H][C@]12c3cc(O)cc4c3[C@@]([H])(c3cc(O)cc5c3[C@@]([H])(c3cc(O)cc(c31)O[C@@H]2c1ccc(O)cc1)[C@H](c1ccc(O)cc1)O5)[C@H](c1ccc(O)cc1)O4 |
| InChI | InChI=1S/C42H30O9/c43-22-7-1-19(2-8-22)40-37-28-13-25(46)17-32-35(28)39(42(50-32)21-5-11-24(45)12-6-21)30-15-27(48)18-33-36(30)38(29-14-26(47)16-31(49-40)34(29)37)41(51-33)20-3-9-23(44)10-4-20/h1-18,37-48H/t37-,38-,39+,40+,41+,42-/m1/s1 |
| InChIKey | KUTVNHOAKHJJFL-ZSIJVUTGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caragana (ncbitaxon:20483) | root (BTO:0001188) | PubMed (2337958) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-α-viniferin (CHEBI:66359) has functional parent resveratrol (CHEBI:27881) |
| (+)-α-viniferin (CHEBI:66359) has role anti-inflammatory agent (CHEBI:67079) |
| (+)-α-viniferin (CHEBI:66359) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| (+)-α-viniferin (CHEBI:66359) has role plant metabolite (CHEBI:76924) |
| (+)-α-viniferin (CHEBI:66359) is a 1-benzofurans (CHEBI:38830) |
| (+)-α-viniferin (CHEBI:66359) is a macrocycle (CHEBI:51026) |
| (+)-α-viniferin (CHEBI:66359) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2R,2aR,7R,7aR,12S,12aS)-2,7,12-tris(4-hydroxyphenyl)-2,2a,7,7a,12,12a-hexahydrobis[1]benzofuro[3',4':4,5,6;3'',4'':7,8,9]cyclonona[1,2,3-cd][1]benzofuran-4,9,14-triol |
| Synonym | Source |
|---|---|
| α-viniferin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Alpha-Viniferin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3644570 | Reaxys |
| CAS:62218-13-7 | ChemIDplus |
| Citations |
|---|