EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H28N6O7S4 |
| Net Charge | 0 |
| Average Mass | 712.857 |
| Monoisotopic Mass | 712.09023 |
| SMILES | [H][C@]12Nc3ccccc3[C@@]1([C@]13c4ccccc4N[C@]1([H])N1C(=O)CN(C)C(=O)[C@@]1(SS)[C@@H]3O)[C@H](O)[C@@]13SS[C@](C(C)=O)(C(=O)N12)N(C)C3=O |
| InChI | InChI=1S/C30H28N6O7S4/c1-13(37)28-25(43)36-22-27(15-9-5-7-11-17(15)32-22,20(40)30(36,47-46-28)24(42)34(28)3)26-14-8-4-6-10-16(14)31-21(26)35-18(38)12-33(2)23(41)29(35,45-44)19(26)39/h4-11,19-22,31-32,39-40,44H,12H2,1-3H3/t19-,20+,21-,22-,26+,27-,28+,29+,30+/m1/s1 |
| InChIKey | CVDBEMJTPGTIID-UCBOEGAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bionectria byssicola (ncbitaxon:160290) | - | PubMed (17390590) | Strain: F120 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Verticillin G (CHEBI:66357) has role metabolite (CHEBI:25212) |
| Verticillin G (CHEBI:66357) is a pyrroloindole (CHEBI:48133) |
| Citations |
|---|