EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N6O5S2 |
| Net Charge | 0 |
| Average Mass | 518.621 |
| Monoisotopic Mass | 518.14061 |
| SMILES | Cc1oc2nc1C(=O)N[C@H]([C@@H](C)O)c1nc(cs1)C(=O)N[C@H](C(C)C)c1nc(cs1)C(=O)N[C@@H]2C |
| InChI | InChI=1S/C22H26N6O5S2/c1-8(2)14-21-24-12(6-34-21)17(30)23-9(3)20-28-16(11(5)33-20)19(32)27-15(10(4)29)22-25-13(7-35-22)18(31)26-14/h6-10,14-15,29H,1-5H3,(H,23,30)(H,26,31)(H,27,32)/t9-,10-,14-,15-/m1/s1 |
| InChIKey | BJJVHBJYOXGRRO-XEQNPHJVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria sp. (ncbitaxon:1159) | - | PubMed (17328572) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| venturamide B (CHEBI:66354) has role antimalarial (CHEBI:38068) |
| venturamide B (CHEBI:66354) has role metabolite (CHEBI:25212) |
| venturamide B (CHEBI:66354) is a 1,3-oxazoles (CHEBI:46812) |
| venturamide B (CHEBI:66354) is a 1,3-thiazoles (CHEBI:38418) |
| venturamide B (CHEBI:66354) is a homodetic cyclic peptide (CHEBI:24613) |
| venturamide B (CHEBI:66354) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (4R,11R,18R)-11-[(1R)-1-hydroxyethyl]-4,7-dimethyl-18-(propan-2-yl)-6-oxa-13,20-dithia-3,10,17,22,23,24-hexaazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),7,12(23),14,19(22)-hexaene-2,9,16-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11058869 | Reaxys |
| Citations |
|---|