EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O6 |
| Net Charge | 0 |
| Average Mass | 316.309 |
| Monoisotopic Mass | 316.09469 |
| SMILES | COC(=O)c1c(O)cc(C)cc1CC1=CC(=O)C=C(OC)C1=O |
| InChI | InChI=1S/C17H16O6/c1-9-4-10(15(13(19)5-9)17(21)23-3)6-11-7-12(18)8-14(22-2)16(11)20/h4-5,7-8,19H,6H2,1-3H3 |
| InChIKey | CGSNFYSSVZXFAX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus variecolor (ncbitaxon:469282) | - | PubMed (17965475) | Strain: B 17 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| variecolorquinone B (CHEBI:66351) has role Aspergillus metabolite (CHEBI:76956) |
| variecolorquinone B (CHEBI:66351) has role antineoplastic agent (CHEBI:35610) |
| variecolorquinone B (CHEBI:66351) is a 1,4-benzoquinones (CHEBI:132124) |
| variecolorquinone B (CHEBI:66351) is a aromatic ester (CHEBI:62732) |
| variecolorquinone B (CHEBI:66351) is a methyl ester (CHEBI:25248) |
| variecolorquinone B (CHEBI:66351) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| methyl 2-hydroxy-6-[(5-methoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]-4-methylbenzoate |
| Citations |
|---|