EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O9 |
| Net Charge | 0 |
| Average Mass | 402.355 |
| Monoisotopic Mass | 402.09508 |
| SMILES | COc1cc(O)cc2c1C(=O)c1c(cc(C)c(C(=O)OC[C@@H](O)CO)c1O)C2=O |
| InChI | InChI=1S/C20H18O9/c1-8-3-11-16(18(25)14(8)20(27)29-7-10(23)6-21)19(26)15-12(17(11)24)4-9(22)5-13(15)28-2/h3-5,10,21-23,25H,6-7H2,1-2H3/t10-/m0/s1 |
| InChIKey | BFHKLXFIZWDGDV-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus variecolor (ncbitaxon:469282) | - | PubMed (17965475) | Strain: B 17 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| variecolorquinone A (CHEBI:66350) has role Aspergillus metabolite (CHEBI:76956) |
| variecolorquinone A (CHEBI:66350) has role antineoplastic agent (CHEBI:35610) |
| variecolorquinone A (CHEBI:66350) is a aromatic ester (CHEBI:62732) |
| variecolorquinone A (CHEBI:66350) is a aromatic ether (CHEBI:35618) |
| variecolorquinone A (CHEBI:66350) is a dihydroxyanthraquinone (CHEBI:37484) |
| variecolorquinone A (CHEBI:66350) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2S)-2,3-dihydroxypropyl 1,6-dihydroxy-8-methoxy-3-methyl-9,10-dioxo-9,10-dihydroanthracene-2-carboxylate |
| Citations |
|---|