EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O9 |
| Net Charge | 0 |
| Average Mass | 378.333 |
| Monoisotopic Mass | 378.09508 |
| SMILES | COC(=O)Cc1c(O)cc(O)cc1OC(=O)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C18H18O9/c1-24-14-4-9(5-15(25-2)17(14)22)18(23)27-13-7-10(19)6-12(20)11(13)8-16(21)26-3/h4-7,19-20,22H,8H2,1-3H3 |
| InChIKey | HTYXVCATPMWMSN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vaccinium ashei (IPNI:261790-2) | fruit (BTO:0000486) | PubMed (12372879) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vaccihein A (CHEBI:66346) has role antioxidant (CHEBI:22586) |
| vaccihein A (CHEBI:66346) has role metabolite (CHEBI:25212) |
| vaccihein A (CHEBI:66346) is a benzoate ester (CHEBI:36054) |
| vaccihein A (CHEBI:66346) is a dimethoxybenzene (CHEBI:51681) |
| vaccihein A (CHEBI:66346) is a methyl ester (CHEBI:25248) |
| vaccihein A (CHEBI:66346) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-(2-methoxy-2-oxoethyl)phenyl 4-hydroxy-3,5-dimethoxybenzoate |
| Synonym | Source |
|---|---|
| methyl 2-(3,5-dimethoxy-4-hydroxybenzoyloxy)-4,6-dihydroxyphenyl acetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9293144 | Reaxys |
| Citations |
|---|