EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H12Br2O6 |
| Net Charge | 0 |
| Average Mass | 520.129 |
| Monoisotopic Mass | 517.90006 |
| SMILES | Oc1cc(Cc2c(O)c(O)c3oc4c(O)c(Br)cc5ccc2c3c54)cc(Br)c1O |
| InChI | InChI=1S/C21H12Br2O6/c22-11-4-7(5-13(24)17(11)26)3-10-9-2-1-8-6-12(23)18(27)20-14(8)15(9)21(29-20)19(28)16(10)25/h1-2,4-6,24-28H,3H2 |
| InChIKey | MUCAQKAQNJJHBH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Polysiphonia urceolata (ncbitaxon:65404) | - | PubMed (18324823) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Urceolatin (CHEBI:66344) has role metabolite (CHEBI:25212) |
| Urceolatin (CHEBI:66344) is a phenanthrol (CHEBI:25962) |
| Synonym | Source |
|---|---|
| 6-Bromo-1-(3-bromo-4,5-dihydroxybenzyl)phenanthro[4,5-bcd]furan-2,3,5-triol | ChEBI |
| Citations |
|---|