EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44N2O |
| Net Charge | 0 |
| Average Mass | 436.684 |
| Monoisotopic Mass | 436.34536 |
| SMILES | [H][C@]12CC[C@@]3(C)C(=C1C=CC1=C[C@H](NC(N)=O)CC[C@@]12C)CC[C@]3([H])[C@H](C)/C=C/[C@H](C)C(C)C |
| InChI | InChI=1S/C29H44N2O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(31-27(30)32)13-15-28(21,5)26(23)14-16-29(24,25)6/h7-10,17-20,22,24,26H,11-16H2,1-6H3,(H3,30,31,32)/b8-7+/t19-,20+,22+,24+,26-,28-,29+/m0/s1 |
| InChIKey | QMRIXJXCSWHXLU-JEFNDHMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlorophyllum molybdites (ncbitaxon:34430) | fruit (BTO:0000486) | PubMed (11515573) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (22S,24R)-3α-ureido-ergosta-4,6,8(14),22-tetraene (CHEBI:66343) has role fungal metabolite (CHEBI:76946) |
| (22S,24R)-3α-ureido-ergosta-4,6,8(14),22-tetraene (CHEBI:66343) is a ergostanoid (CHEBI:50403) |
| (22S,24R)-3α-ureido-ergosta-4,6,8(14),22-tetraene (CHEBI:66343) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 1-[(3α,22E)-ergosta-4,6,8(14),22-tetraen-3-yl]urea |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9022305 | Reaxys |
| Citations |
|---|