EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N2O9 |
| Net Charge | 0 |
| Average Mass | 526.542 |
| Monoisotopic Mass | 526.19513 |
| SMILES | C/C=C(\C)C(=O)OC1C(C)OC(=O)C(NC(=O)c2nccc(OC)c2O)COC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C27H30N2O9/c1-5-15(2)25(32)38-23-16(3)37-27(34)19(29-24(31)21-22(30)20(35-4)11-12-28-21)14-36-26(33)18(23)13-17-9-7-6-8-10-17/h5-12,16,18-19,23,30H,13-14H2,1-4H3,(H,29,31)/b15-5+ |
| InChIKey | NRCFYQYMBDTOBT-PJQLUOCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | mycelium (BTO:0001436) | PubMed (8784423) | Strain: 517-02 |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UK-2B (CHEBI:66340) has role antifungal agent (CHEBI:35718) |
| UK-2B (CHEBI:66340) has role antimicrobial agent (CHEBI:33281) |
| UK-2B (CHEBI:66340) has role bacterial metabolite (CHEBI:76969) |
| UK-2B (CHEBI:66340) is a aromatic amide (CHEBI:62733) |
| UK-2B (CHEBI:66340) is a aromatic ether (CHEBI:35618) |
| UK-2B (CHEBI:66340) is a lactone (CHEBI:25000) |
| UK-2B (CHEBI:66340) is a monocarboxylic acid amide (CHEBI:29347) |
| UK-2B (CHEBI:66340) is a monohydroxypyridine (CHEBI:38182) |
| Synonym | Source |
|---|---|
| 8-benzyl-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl (2E)-2-methylbut-2-enoate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7611502 | Reaxys |
| Citations |
|---|