EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30N2O9 |
| Net Charge | 0 |
| Average Mass | 514.531 |
| Monoisotopic Mass | 514.19513 |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)C(Cc3ccccc3)[C@@H](OC(=O)C(C)C)C(C)OC2=O)c1O |
| InChI | InChI=1S/C26H30N2O9/c1-14(2)24(31)37-22-15(3)36-26(33)18(28-23(30)20-21(29)19(34-4)10-11-27-20)13-35-25(32)17(22)12-16-8-6-5-7-9-16/h5-11,14-15,17-18,22,29H,12-13H2,1-4H3,(H,28,30)/t15?,17?,18-,22-/m0/s1 |
| InChIKey | MLGCATYQZVMGBG-DRHHIBKESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | mycelium (BTO:0001436) | PubMed (8784423) | Strain: 517-02 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UK-2A (CHEBI:66339) has role antifungal agent (CHEBI:35718) |
| UK-2A (CHEBI:66339) has role antimicrobial agent (CHEBI:33281) |
| UK-2A (CHEBI:66339) has role bacterial metabolite (CHEBI:76969) |
| UK-2A (CHEBI:66339) is a aromatic amide (CHEBI:62733) |
| UK-2A (CHEBI:66339) is a aromatic ether (CHEBI:35618) |
| UK-2A (CHEBI:66339) is a lactone (CHEBI:25000) |
| UK-2A (CHEBI:66339) is a monocarboxylic acid amide (CHEBI:29347) |
| UK-2A (CHEBI:66339) is a monohydroxypyridine (CHEBI:38182) |
| Synonym | Source |
|---|---|
| (3S,7R)-8-benzyl-3-{[(3-hydroxy-4-methoxypyridin-2-yl)carbonyl]amino}-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl 2-methylpropanoate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8124863 | Reaxys |
| Citations |
|---|