EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO5 |
| Net Charge | 0 |
| Average Mass | 387.476 |
| Monoisotopic Mass | 387.20457 |
| SMILES | [H][C@@]1(C(=O)[C@H]2[C@@H](C)C=C[C@@]3(C)CCCC[C@]23C)C(=O)N2CC[C@@]3([H])C(=O)O[C@]1([H])[C@@]23O |
| InChI | InChI=1S/C22H29NO5/c1-12-6-10-20(2)8-4-5-9-21(20,3)15(12)16(24)14-17-22(27)13(19(26)28-17)7-11-23(22)18(14)25/h6,10,12-15,17,27H,4-5,7-9,11H2,1-3H3/t12-,13-,14-,15+,17-,20+,21+,22+/m0/s1 |
| InChIKey | WOAILDKFDXKSIY-OMKDVXPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acremonium (ncbitaxon:5045) | - | PubMed (10819301) | Strain: KY4917 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UCS1025 A (CHEBI:66338) has role antibacterial agent (CHEBI:33282) |
| UCS1025 A (CHEBI:66338) has role antimicrobial agent (CHEBI:33281) |
| UCS1025 A (CHEBI:66338) has role antineoplastic agent (CHEBI:35610) |
| UCS1025 A (CHEBI:66338) has role metabolite (CHEBI:25212) |
| UCS1025 A (CHEBI:66338) is a ketone (CHEBI:17087) |
| UCS1025 A (CHEBI:66338) is a lactam (CHEBI:24995) |
| UCS1025 A (CHEBI:66338) is a octahydronaphthalenes (CHEBI:138397) |
| UCS1025 A (CHEBI:66338) is a organic heterotricyclic compound (CHEBI:26979) |
| UCS1025 A (CHEBI:66338) is a tertiary alcohol (CHEBI:26878) |
| UCS1025 A (CHEBI:66338) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (2aR,7R,7aS,7bR)-7b-hydroxy-7-{[(1S,2S,4aR,8aR)-2,4a,8a-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]carbonyl}hexahydrofuro[2,3,4-gh]pyrrolizine-2,6-dione |
| Citations |
|---|