EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O4 |
| Net Charge | 0 |
| Average Mass | 358.478 |
| Monoisotopic Mass | 358.21441 |
| SMILES | [H][C@@]12CC/C(C)=C/CC(C)(C)/C=C/C[C@@]1(C)OC1=C(O)C(=O)[C@@]3([H])CO[C@]2([H])[C@@]13[H] |
| InChI | InChI=1S/C22H30O4/c1-13-6-7-15-19-16-14(12-25-19)17(23)18(24)20(16)26-22(15,4)10-5-9-21(2,3)11-8-13/h5,8-9,14-16,19,24H,6-7,10-12H2,1-4H3/b9-5+,13-8+/t14-,15-,16-,19-,22+/m0/s1 |
| InChIKey | WDFUVZRTUNQXHC-KVPIFFDFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarocladium strictum (ncbitaxon:5046) | - | PubMed (7649852) |
| Roles Classification |
|---|
| Biological Roles: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xenovulene A (CHEBI:66336) has role GABA antagonist (CHEBI:65259) |
| xenovulene A (CHEBI:66336) has role metabolite (CHEBI:25212) |
| xenovulene A (CHEBI:66336) is a cyclic ether (CHEBI:37407) |
| xenovulene A (CHEBI:66336) is a enone (CHEBI:51689) |
| xenovulene A (CHEBI:66336) is a organic heterotetracyclic compound (CHEBI:38163) |
| xenovulene A (CHEBI:66336) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (2aR,5aR,11E,14aS,14bS,14cS)-4-hydroxy-5a,9,9,12-tetramethyl-2a,5a,6,9,10,13,14,14a,14b,14c-decahydro-1,5-dioxacyclopenta[cd]cycloundeca[f]inden-3(2)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7310576 | Reaxys |
| Citations |
|---|