EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | C=C(C)C(O)Cc1c(O)cc(OC)c(C(=O)/C=C/c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C21H22O6/c1-12(2)17(24)10-15-18(25)11-19(27-3)20(21(15)26)16(23)9-6-13-4-7-14(22)8-5-13/h4-9,11,17,22,24-26H,1,10H2,2-3H3/b9-6+ |
| InChIKey | IIWLGOCXDBSFCM-RMKNXTFCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus (ncbitaxon:3486) | - | PubMed (15679315) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthohumol D (CHEBI:66335) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| xanthohumol D (CHEBI:66335) has role metabolite (CHEBI:25212) |
| xanthohumol D (CHEBI:66335) is a aromatic ether (CHEBI:35618) |
| xanthohumol D (CHEBI:66335) is a chalcones (CHEBI:23086) |
| xanthohumol D (CHEBI:66335) is a polyphenol (CHEBI:26195) |
| xanthohumol D (CHEBI:66335) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2E)-1-[2,4-dihydroxy-3-(2-hydroxy-3-methylbut-3-en-1-yl)-6-methoxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 3'-(2-hydroxy-3-methylbutyl-3-enyl)-4,2',4'-trihydroxy-6'-methoxychalcone | ChEBI |
| rac-(2E)-1-{2,4-dihydroxy-3-[2-hydroxy-3-methyl-3-but-3-enyl]-6-methoxyphenyl}-3-(4-hydroxyphenyl)-2-propen-1-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 552946 | ChemSpider |
| CPD-7129 | MetaCyc |
| HMDB0035003 | HMDB |
| LMPK12120295 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8587407 | Reaxys |
| Citations |
|---|