EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | COc1cc2c(c(O)c1C(=O)/C=C/c1ccc(O)cc1)CC(O)C(C)(C)O2 |
| InChI | InChI=1S/C21H22O6/c1-21(2)18(24)10-14-16(27-21)11-17(26-3)19(20(14)25)15(23)9-6-12-4-7-13(22)8-5-12/h4-9,11,18,22,24-25H,10H2,1-3H3/b9-6+ |
| InChIKey | GUQGMEWOCKDLDE-RMKNXTFCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus (ncbitaxon:3486) | - | PubMed (15679315) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthohumol B (CHEBI:66334) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| xanthohumol B (CHEBI:66334) has role metabolite (CHEBI:25212) |
| xanthohumol B (CHEBI:66334) is a aromatic ether (CHEBI:35618) |
| xanthohumol B (CHEBI:66334) is a chalcones (CHEBI:23086) |
| xanthohumol B (CHEBI:66334) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2E)-1-(3,5-dihydroxy-7-methoxy-2,2-dimethyl-3,4-dihydro-2H-chromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| rac-6'',6''-dimethyl-5''-hydroxy-4'',5''-dihydropyrano[2'',3'':4',3']-4,2'-dihydroxy-6'-methoxychalcone | ChEBI |
| rac-(E)-1-(3,5-dihydroxy-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one | ChEBI |
| rac-6-[3,4-dihydro-3,5-dihydroxy-7-methoxy-2,2-dimethyl-2H-benzo[b]pyrano]-3-(4-hydroxyphenyl)-2-propen-1-one | ChEBI |
| Dehydrocycloxanthohumol hydrate | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| CPD-7127 | MetaCyc |
| LMPK12120299 | LIPID MAPS |
| HMDB0034867 | HMDB |
| EP2277526 | Patent |
| US2007218155 | Patent |
| WO2008095189 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7828262 | Reaxys |
| Citations |
|---|