EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O5 |
| Net Charge | 0 |
| Average Mass | 356.418 |
| Monoisotopic Mass | 356.16237 |
| SMILES | COc1cc(O)c(CC=C(C)C)c(O)c1C(=O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C21H24O5/c1-13(2)4-10-16-18(24)12-19(26-3)20(21(16)25)17(23)11-7-14-5-8-15(22)9-6-14/h4-6,8-9,12,22,24-25H,7,10-11H2,1-3H3 |
| InChIKey | SVTCZHIDEDUTBH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus (ncbitaxon:3486) | - | PubMed (15679315) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroxanthohumol (CHEBI:66332) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| dihydroxanthohumol (CHEBI:66332) has role metabolite (CHEBI:25212) |
| dihydroxanthohumol (CHEBI:66332) is a aromatic ether (CHEBI:35618) |
| dihydroxanthohumol (CHEBI:66332) is a dihydrochalcones (CHEBI:71230) |
| dihydroxanthohumol (CHEBI:66332) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-(4-hydroxyphenyl)propan-1-one |
| Synonyms | Source |
|---|---|
| 4,2',4'-trihydroxy-6'-methoxy-3'-prenyldihydrochalcone | ChEBI |
| α,β-dihydroxanthohumol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035440 | HMDB |
| LMPK12120536 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3446881 | Reaxys |
| Citations |
|---|